C24H39NO8 — CID 171703101
(1S,2R,3R,4R,5S,6S,7S,8R,9R,10R,13S,17R,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8-tetrol (PubChem CID 171703101) has the molecular formula C24H39NO8 and a molecular weight of 469.58 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S,6S,7S,8R,9R,10R,13S,17R,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8-tetrol.
| Compound Name | (1S,2R,3R,4R,5S,6S,7S,8R,9R,10R,13S,17R,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8-tetrol |
|---|---|
| PubChem CID | 171703101 |
| Molecular Formula | C24H39NO8 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | (1S,2R,3R,4R,5S,6S,7S,8R,9R,10R,13S,17R,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8-tetrol |
| SMILES | COC[C@@]12CCC(OC)[C@@]34[C@@H]5C[C@]6(O)[C@H](O)[C@@H]5[C@@](O)([C@@H]([C@H](OC)[C@H]13)[C@H]4N(C)C2)[C@@H](O)[C@@H]6OC |
| InChI | InChI=1S/C24H39NO8/c1-25-9-21(10-30-2)7-6-12(31-3)23-11-8-22(28)18(26)13(11)24(29,19(27)20(22)33-5)14(17(23)25)15(32-4)16(21)23/h11-20,26-29H,6-10H2,1-5H3/t11-,12?,13-,14+,15+,16-,17-,18-,19+,20+,21+,22+,23+,24-/m1/s1 |
| InChIKey | BQTYHFZQSAKNQU-HTLUNRKHSA-N |
| XLogP | -1.15 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |