About 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole
4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole (PubChem CID 171704465) has the molecular formula C19H21N3O3S
and a molecular weight of 371.46 g/mol. Its IUPAC name is 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole |
| PubChem CID | 171704465 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole |
| SMILES | COc1ccc(OC)c2sc(N3CCC(COc4ccncc4)C3)nc12 |
| InChI | InChI=1S/C19H21N3O3S/c1-23-15-3-4-16(24-2)18-17(15)21-19(26-18)22-10-7-13(11-22)12-25-14-5-8-20-9-6-14/h3-6,8-9,13H,7,10-12H2,1-2H3 |
| InChIKey | ZCUPJFCNCYGVDP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole?
The IUPAC name of 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole (CID 171704465) is 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole.
What is the SMILES notation for 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole?
The canonical SMILES for 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole is COc1ccc(OC)c2sc(N3CCC(COc4ccncc4)C3)nc12.
What is the InChIKey of 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole?
The InChIKey is ZCUPJFCNCYGVDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O3S/c1-23-15-3-4-16(24-2)18-17(15)21-19(26-18)22-10-7-13(11-22)12-25-14-5-8-20-9-6-14/h3-6,8-9,13H,7,10-12H2,1-2H3.
What are the key properties of 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole?
4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole has a molecular weight of 371.46 g/mol, XLogP of 3.61, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethoxy-2-[3-(pyridin-4-yloxymethyl)pyrrolidin-1-yl]-1,3-benzothiazole is sourced from PubChem (CID 171704465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).