About 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole
3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole (PubChem CID 171704666) has the molecular formula C16H13FN2O
and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole |
| PubChem CID | 171704666 |
| Molecular Formula | C16H13FN2O |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole |
| SMILES | Fc1ccc2onc(CN3CCc4ccccc43)c2c1 |
| InChI | InChI=1S/C16H13FN2O/c17-12-5-6-16-13(9-12)14(18-20-16)10-19-8-7-11-3-1-2-4-15(11)19/h1-6,9H,7-8,10H2 |
| InChIKey | YQZZKESYCWUEBR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole?
The IUPAC name of 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole (CID 171704666) is 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole.
What is the SMILES notation for 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole?
The canonical SMILES for 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole is Fc1ccc2onc(CN3CCc4ccccc43)c2c1.
What is the InChIKey of 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole?
The InChIKey is YQZZKESYCWUEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O/c17-12-5-6-16-13(9-12)14(18-20-16)10-19-8-7-11-3-1-2-4-15(11)19/h1-6,9H,7-8,10H2.
What are the key properties of 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole?
3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole has a molecular weight of 268.29 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroindol-1-ylmethyl)-5-fluoro-1,2-benzoxazole is sourced from PubChem (CID 171704666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).