C14H20F3N3O3S — CID 171705428
N,N-diethyl-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171705428) has the molecular formula C14H20F3N3O3S and a molecular weight of 367.39 g/mol. Its IUPAC name is N,N-diethyl-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-diethyl-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171705428 |
| Molecular Formula | C14H20F3N3O3S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N,N-diethyl-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)C(=O)c1nc2c(s1)CCNCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H19N3OS.C2HF3O2/c1-3-15(4-2)12(16)11-14-9-5-7-13-8-6-10(9)17-11;3-2(4,5)1(6)7/h13H,3-8H2,1-2H3;(H,6,7) |
| InChIKey | UBGMNCYUWKZCGN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |