C24H29F3N4O5 — CID 171705435
1'-(3-methylbutanoyl)-N-phenylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171705435) has the molecular formula C24H29F3N4O5 and a molecular weight of 510.51 g/mol. Its IUPAC name is 1'-(3-methylbutanoyl)-N-phenylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1'-(3-methylbutanoyl)-N-phenylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171705435 |
| Molecular Formula | C24H29F3N4O5 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 1'-(3-methylbutanoyl)-N-phenylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CC(=O)N1CCC2(CC1)OC(C(=O)Nc1ccccc1)Cn1ccnc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H28N4O3.C2HF3O2/c1-16(2)14-19(27)25-11-8-22(9-12-25)21-23-10-13-26(21)15-18(29-22)20(28)24-17-6-4-3-5-7-17;3-2(4,5)1(6)7/h3-7,10,13,16,18H,8-9,11-12,14-15H2,1-2H3,(H,24,28);(H,6,7) |
| InChIKey | PKLTYJVIDRISSG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |