C37H45N2O2+ — CID 171705499
6-[(2E)-3,3-dimethyl-2-[(2E)-2-[3-[(Z)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indol-1-yl]hexanoic acid (PubChem CID 171705499) has the molecular formula C37H45N2O2+ and a molecular weight of 549.78 g/mol. Its IUPAC name is 6-[(2E)-3,3-dimethyl-2-[(2E)-2-[3-[(Z)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indol-1-yl]hexanoic acid.
| Compound Name | 6-[(2E)-3,3-dimethyl-2-[(2E)-2-[3-[(Z)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 171705499 |
| Molecular Formula | C37H45N2O2+ |
| Molecular Weight | 549.78 g/mol |
| Exact Mass | 549.35 |
| IUPAC Name | 6-[(2E)-3,3-dimethyl-2-[(2E)-2-[3-[(Z)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indol-1-yl]hexanoic acid |
| SMILES | C[N+]1=C(/C=C\C2=C/C(=C/C=C3/N(CCCCCC(=O)O)c4ccccc4C3(C)C)CCC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C37H44N2O2/c1-36(2)29-16-8-10-18-31(29)38(5)33(36)23-21-27-14-13-15-28(26-27)22-24-34-37(3,4)30-17-9-11-19-32(30)39(34)25-12-6-7-20-35(40)41/h8-11,16-19,21-24,26H,6-7,12-15,20,25H2,1-5H3/p+1 |
| InChIKey | JDYZFLVOSHJYKA-UHFFFAOYSA-O |
| XLogP | 8.61 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.78 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|