C18H16F3N3O6S — CID 171705762
2-methylsulfonyl-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]-4-(trifluoromethyl)benzamide (PubChem CID 171705762) has the molecular formula C18H16F3N3O6S and a molecular weight of 459.40 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-methylsulfonyl-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171705762 |
| Molecular Formula | C18H16F3N3O6S |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 2-methylsulfonyl-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]-4-(trifluoromethyl)benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(C(F)(F)F)cc1S(C)(=O)=O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16F3N3O6S/c1-10(16(25)23-12-4-6-13(7-5-12)24(27)28)22-17(26)14-8-3-11(18(19,20)21)9-15(14)31(2,29)30/h3-10H,1-2H3,(H,22,26)(H,23,25)/t10-/m0/s1 |
| InChIKey | PRVBDCCNXZPEMY-JTQLQIEISA-N |
| XLogP | 2.77 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|