C22H30N2O4 — CID 171707581
2-(6-ethoxy-2,3-dihydro-1H-inden-5-yl)-1-(4-methoxycyclohexyl)imidazole;formic acid (PubChem CID 171707581) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-(6-ethoxy-2,3-dihydro-1H-inden-5-yl)-1-(4-methoxycyclohexyl)imidazole;formic acid.
| Compound Name | 2-(6-ethoxy-2,3-dihydro-1H-inden-5-yl)-1-(4-methoxycyclohexyl)imidazole;formic acid |
|---|---|
| PubChem CID | 171707581 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2-(6-ethoxy-2,3-dihydro-1H-inden-5-yl)-1-(4-methoxycyclohexyl)imidazole;formic acid |
| SMILES | CCOc1cc2c(cc1-c1nccn1C1CCC(OC)CC1)CCC2.O=CO |
| InChI | InChI=1S/C21H28N2O2.CH2O2/c1-3-25-20-14-16-6-4-5-15(16)13-19(20)21-22-11-12-23(21)17-7-9-18(24-2)10-8-17;2-1-3/h11-14,17-18H,3-10H2,1-2H3;1H,(H,2,3) |
| InChIKey | NHOBPGHAFFQNSC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|