C21H24N6O4 — CID 171707917
2-(1,3-dimethylpyrazol-4-yl)-6-(1-methylpiperidin-4-yl)-3H-pyrrolo[3,4-f]benzimidazole-5,7-dione;formic acid (PubChem CID 171707917) has the molecular formula C21H24N6O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-(1,3-dimethylpyrazol-4-yl)-6-(1-methylpiperidin-4-yl)-3H-pyrrolo[3,4-f]benzimidazole-5,7-dione;formic acid.
| Compound Name | 2-(1,3-dimethylpyrazol-4-yl)-6-(1-methylpiperidin-4-yl)-3H-pyrrolo[3,4-f]benzimidazole-5,7-dione;formic acid |
|---|---|
| PubChem CID | 171707917 |
| Molecular Formula | C21H24N6O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-(1,3-dimethylpyrazol-4-yl)-6-(1-methylpiperidin-4-yl)-3H-pyrrolo[3,4-f]benzimidazole-5,7-dione;formic acid |
| SMILES | Cc1nn(C)cc1-c1nc2cc3c(cc2[nH]1)C(=O)N(C1CCN(C)CC1)C3=O.O=CO |
| InChI | InChI=1S/C20H22N6O2.CH2O2/c1-11-15(10-25(3)23-11)18-21-16-8-13-14(9-17(16)22-18)20(28)26(19(13)27)12-4-6-24(2)7-5-12;2-1-3/h8-10,12H,4-7H2,1-3H3,(H,21,22);1H,(H,2,3) |
| InChIKey | MLQKXLKLCKCNHV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|