C20H23Cl2FN2 — CID 171708029
(3R,3aS,6aR)-5-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 171708029) has the molecular formula C20H23Cl2FN2 and a molecular weight of 381.32 g/mol. Its IUPAC name is (3R,3aS,6aR)-5-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3R,3aS,6aR)-5-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 171708029 |
| Molecular Formula | C20H23Cl2FN2 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (3R,3aS,6aR)-5-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | CN1C[C@H]2CN(Cc3ccc(F)c(Cl)c3)C[C@H]2[C@@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C20H22ClFN2.ClH/c1-23-11-16-12-24(10-14-7-8-19(22)18(21)9-14)13-17(16)20(23)15-5-3-2-4-6-15;/h2-9,16-17,20H,10-13H2,1H3;1H/t16-,17+,20-;/m0./s1 |
| InChIKey | IYYPVFDMURCUIV-QYOIUNHHSA-N |
| XLogP | 4.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |