C22H21N3O4 — CID 171708438
formic acid;3-(6-oxo-1H-pyridazin-3-yl)-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide (PubChem CID 171708438) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is formic acid;3-(6-oxo-1H-pyridazin-3-yl)-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide.
| Compound Name | formic acid;3-(6-oxo-1H-pyridazin-3-yl)-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide |
|---|---|
| PubChem CID | 171708438 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | formic acid;3-(6-oxo-1H-pyridazin-3-yl)-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide |
| SMILES | O=C(NC1CCc2ccccc2C1)c1cccc(-c2ccc(=O)[nH]n2)c1.O=CO |
| InChI | InChI=1S/C21H19N3O2.CH2O2/c25-20-11-10-19(23-24-20)16-6-3-7-17(12-16)21(26)22-18-9-8-14-4-1-2-5-15(14)13-18;2-1-3/h1-7,10-12,18H,8-9,13H2,(H,22,26)(H,24,25);1H,(H,2,3) |
| InChIKey | HFUOEVOKBPCSII-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|