C18H28N2O6S — CID 171709946
2-[[1-[3-(dimethylsulfamoyl)propyl]pyrrolidin-3-yl]methyl]benzoic acid;formic acid (PubChem CID 171709946) has the molecular formula C18H28N2O6S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[[1-[3-(dimethylsulfamoyl)propyl]pyrrolidin-3-yl]methyl]benzoic acid;formic acid.
| Compound Name | 2-[[1-[3-(dimethylsulfamoyl)propyl]pyrrolidin-3-yl]methyl]benzoic acid;formic acid |
|---|---|
| PubChem CID | 171709946 |
| Molecular Formula | C18H28N2O6S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[[1-[3-(dimethylsulfamoyl)propyl]pyrrolidin-3-yl]methyl]benzoic acid;formic acid |
| SMILES | CN(C)S(=O)(=O)CCCN1CCC(Cc2ccccc2C(=O)O)C1.O=CO |
| InChI | InChI=1S/C17H26N2O4S.CH2O2/c1-18(2)24(22,23)11-5-9-19-10-8-14(13-19)12-15-6-3-4-7-16(15)17(20)21;2-1-3/h3-4,6-7,14H,5,8-13H2,1-2H3,(H,20,21);1H,(H,2,3) |
| InChIKey | VEEIKZAWQQCMLF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|