C20H28N4O4S — CID 171710008
(3aR,4R,6aS)-5-(1-ethyl-3-methylpyrazol-4-yl)sulfonyl-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;acetic acid (PubChem CID 171710008) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is (3aR,4R,6aS)-5-(1-ethyl-3-methylpyrazol-4-yl)sulfonyl-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;acetic acid.
| Compound Name | (3aR,4R,6aS)-5-(1-ethyl-3-methylpyrazol-4-yl)sulfonyl-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;acetic acid |
|---|---|
| PubChem CID | 171710008 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (3aR,4R,6aS)-5-(1-ethyl-3-methylpyrazol-4-yl)sulfonyl-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;acetic acid |
| SMILES | CC(=O)O.CCn1cc(S(=O)(=O)N2C[C@@H]3CNC[C@@H]3[C@@H]2c2ccccc2)c(C)n1 |
| InChI | InChI=1S/C18H24N4O2S.C2H4O2/c1-3-21-12-17(13(2)20-21)25(23,24)22-11-15-9-19-10-16(15)18(22)14-7-5-4-6-8-14;1-2(3)4/h4-8,12,15-16,18-19H,3,9-11H2,1-2H3;1H3,(H,3,4)/t15-,16-,18-;/m0./s1 |
| InChIKey | PUGCWSUWUKVGTQ-OVHUVXHOSA-N |
| XLogP | 1.88 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |