About 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid
2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid (PubChem CID 171710037) has the molecular formula C20H23FN2O4
and a molecular weight of 374.41 g/mol. Its IUPAC name is 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid.
Molecular Properties
| Compound Name | 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid |
| PubChem CID | 171710037 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid |
| SMILES | O=C(O)c1cc(CC2CCN(CCc3cccnc3)C2)ccc1F.O=CO |
| InChI | InChI=1S/C19H21FN2O2.CH2O2/c20-18-4-3-15(11-17(18)19(23)24)10-16-6-9-22(13-16)8-5-14-2-1-7-21-12-14;2-1-3/h1-4,7,11-12,16H,5-6,8-10,13H2,(H,23,24);1H,(H,2,3) |
| InChIKey | LPMQYXWANBTHPU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid?
The IUPAC name of 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid (CID 171710037) is 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid.
What is the SMILES notation for 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid?
The canonical SMILES for 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid is O=C(O)c1cc(CC2CCN(CCc3cccnc3)C2)ccc1F.O=CO.
What is the InChIKey of 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid?
The InChIKey is LPMQYXWANBTHPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FN2O2.CH2O2/c20-18-4-3-15(11-17(18)19(23)24)10-16-6-9-22(13-16)8-5-14-2-1-7-21-12-14;2-1-3/h1-4,7,11-12,16H,5-6,8-10,13H2,(H,23,24);1H,(H,2,3).
What are the key properties of 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid?
2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid has a molecular weight of 374.41 g/mol, XLogP of 2.73, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-[[1-(2-pyridin-3-ylethyl)pyrrolidin-3-yl]methyl]benzoic acid;formic acid is sourced from PubChem (CID 171710037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).