C24H31ClN2O3S — CID 171710143
[(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-(2-phenylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methanone;hydrochloride (PubChem CID 171710143) has the molecular formula C24H31ClN2O3S and a molecular weight of 463.04 g/mol. Its IUPAC name is [(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-(2-phenylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methanone;hydrochloride.
| Compound Name | [(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-(2-phenylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171710143 |
| Molecular Formula | C24H31ClN2O3S |
| Molecular Weight | 463.04 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-(2-phenylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methanone;hydrochloride |
| SMILES | Cl.N[C@H]1CC[C@H](C(=O)N2CCC3(CC2)OCCc2sc(-c4ccccc4)cc23)C[C@@H]1O |
| InChI | InChI=1S/C24H30N2O3S.ClH/c25-19-7-6-17(14-20(19)27)23(28)26-11-9-24(10-12-26)18-15-22(16-4-2-1-3-5-16)30-21(18)8-13-29-24;/h1-5,15,17,19-20,27H,6-14,25H2;1H/t17-,19-,20-;/m0./s1 |
| InChIKey | PAKYGCDJMDKSIV-QEXYDYNRSA-N |
| XLogP | 3.72 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.04 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |