C22H34N4O3 — CID 171710484
(4,6-dimethylpyrimidin-5-yl)-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone;formic acid (PubChem CID 171710484) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is (4,6-dimethylpyrimidin-5-yl)-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone;formic acid.
| Compound Name | (4,6-dimethylpyrimidin-5-yl)-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone;formic acid |
|---|---|
| PubChem CID | 171710484 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (4,6-dimethylpyrimidin-5-yl)-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone;formic acid |
| SMILES | CCC[C@H]1CCC[C@H]2[C@@H]3C[C@@H](CN(C(=O)c4c(C)ncnc4C)C3)CN12.O=CO |
| InChI | InChI=1S/C21H32N4O.CH2O2/c1-4-6-18-7-5-8-19-17-9-16(11-25(18)19)10-24(12-17)21(26)20-14(2)22-13-23-15(20)3;2-1-3/h13,16-19H,4-12H2,1-3H3;1H,(H,2,3)/t16-,17+,18-,19-;/m0./s1 |
| InChIKey | JGDFCUVBZWJHKT-BCWBXWNGSA-N |
| XLogP | 2.91 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|