About methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride
methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride (PubChem CID 171710620) has the molecular formula C20H23ClN2O4
and a molecular weight of 390.87 g/mol. Its IUPAC name is methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride |
| PubChem CID | 171710620 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccccc1C(=O)N[C@]1(c2ccccc2)CCNC[C@H]1O.Cl |
| InChI | InChI=1S/C20H22N2O4.ClH/c1-26-19(25)16-10-6-5-9-15(16)18(24)22-20(11-12-21-13-17(20)23)14-7-3-2-4-8-14;/h2-10,17,21,23H,11-13H2,1H3,(H,22,24);1H/t17-,20+;/m1./s1 |
| InChIKey | SNGRJNSIJTUYQP-XLCHORMMSA-N |
| XLogP | 1.87 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride?
The IUPAC name of methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride (CID 171710620) is methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride.
What is the SMILES notation for methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride?
The canonical SMILES for methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride is COC(=O)c1ccccc1C(=O)N[C@]1(c2ccccc2)CCNC[C@H]1O.Cl.
What is the InChIKey of methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride?
The InChIKey is SNGRJNSIJTUYQP-XLCHORMMSA-N. The full InChI is InChI=1S/C20H22N2O4.ClH/c1-26-19(25)16-10-6-5-9-15(16)18(24)22-20(11-12-21-13-17(20)23)14-7-3-2-4-8-14;/h2-10,17,21,23H,11-13H2,1H3,(H,22,24);1H/t17-,20+;/m1./s1.
What are the key properties of methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride?
methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride has a molecular weight of 390.87 g/mol, XLogP of 1.87, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(3R,4S)-3-hydroxy-4-phenylpiperidin-4-yl]carbamoyl]benzoate;hydrochloride is sourced from PubChem (CID 171710620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).