C17H22ClN3O2 — CID 171710804
5-amino-1-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)pentan-1-one;hydrochloride (PubChem CID 171710804) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is 5-amino-1-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)pentan-1-one;hydrochloride.
| Compound Name | 5-amino-1-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)pentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 171710804 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 5-amino-1-(2-phenyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl)pentan-1-one;hydrochloride |
| SMILES | Cl.NCCCCC(=O)N1CCc2oc(-c3ccccc3)nc2C1 |
| InChI | InChI=1S/C17H21N3O2.ClH/c18-10-5-4-8-16(21)20-11-9-15-14(12-20)19-17(22-15)13-6-2-1-3-7-13;/h1-3,6-7H,4-5,8-12,18H2;1H |
| InChIKey | VSJKEYKYMIJTNE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|