C22H29ClN2O3S — CID 171711507
(3S,3aS,6aR)-5-[2-(benzenesulfonyl)ethyl]-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 171711507) has the molecular formula C22H29ClN2O3S and a molecular weight of 437.01 g/mol. Its IUPAC name is (3S,3aS,6aR)-5-[2-(benzenesulfonyl)ethyl]-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3S,3aS,6aR)-5-[2-(benzenesulfonyl)ethyl]-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 171711507 |
| Molecular Formula | C22H29ClN2O3S |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (3S,3aS,6aR)-5-[2-(benzenesulfonyl)ethyl]-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(CCS(=O)(=O)c4ccccc4)C[C@@H]3CN2C)cc1.Cl |
| InChI | InChI=1S/C22H28N2O3S.ClH/c1-23-14-18-15-24(12-13-28(25,26)20-6-4-3-5-7-20)16-21(18)22(23)17-8-10-19(27-2)11-9-17;/h3-11,18,21-22H,12-16H2,1-2H3;1H/t18-,21+,22+;/m0./s1 |
| InChIKey | FQGMFDNKAHUSMH-ZONMGXSLSA-N |
| XLogP | 3.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |