C22H32N4O5 — CID 171711757
(1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-[2-(2-oxo-1-pyridinyl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid (PubChem CID 171711757) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is (1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-[2-(2-oxo-1-pyridinyl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid.
| Compound Name | (1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-[2-(2-oxo-1-pyridinyl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
|---|---|
| PubChem CID | 171711757 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-[2-(2-oxo-1-pyridinyl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
| SMILES | CN(C)C[C@H]1[C@H]2C[C@H](CN(C(=O)Cn3ccccc3=O)C2)[C@@H]2CCCC(=O)N21.O=CO |
| InChI | InChI=1S/C21H30N4O3.CH2O2/c1-22(2)13-18-16-10-15(17-6-5-8-20(27)25(17)18)11-24(12-16)21(28)14-23-9-4-3-7-19(23)26;2-1-3/h3-4,7,9,15-18H,5-6,8,10-14H2,1-2H3;1H,(H,2,3)/t15-,16+,17+,18+;/m1./s1 |
| InChIKey | JCFYEEWOUCIOBR-BTHRPWOVSA-N |
| XLogP | 0.34 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|