C21H34N6O5 — CID 171712072
2-ethoxy-N-[[(1R,2S,8R,9S)-11-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide;formic acid (PubChem CID 171712072) has the molecular formula C21H34N6O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-ethoxy-N-[[(1R,2S,8R,9S)-11-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide;formic acid.
| Compound Name | 2-ethoxy-N-[[(1R,2S,8R,9S)-11-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide;formic acid |
|---|---|
| PubChem CID | 171712072 |
| Molecular Formula | C21H34N6O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 2-ethoxy-N-[[(1R,2S,8R,9S)-11-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide;formic acid |
| SMILES | CCOCC(=O)NC[C@H]1[C@H]2C[C@H](CN(Cc3nncn3C)C2)[C@@H]2CCCC(=O)N21.O=CO |
| InChI | InChI=1S/C20H32N6O3.CH2O2/c1-3-29-12-19(27)21-8-17-15-7-14(16-5-4-6-20(28)26(16)17)9-25(10-15)11-18-23-22-13-24(18)2;2-1-3/h13-17H,3-12H2,1-2H3,(H,21,27);1H,(H,2,3)/t14-,15+,16+,17+;/m1./s1 |
| InChIKey | GXGMYCVNOXRTLP-UTTFALACSA-N |
| XLogP | -0.13 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|