C18H22N2O5 — CID 17171312
1-(2,5-dimethoxyphenyl)-3-[2-(2-methoxyphenoxy)ethyl]urea (PubChem CID 17171312) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[2-(2-methoxyphenoxy)ethyl]urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[2-(2-methoxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 17171312 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[2-(2-methoxyphenoxy)ethyl]urea |
| SMILES | COc1ccc(OC)c(NC(=O)NCCOc2ccccc2OC)c1 |
| InChI | InChI=1S/C18H22N2O5/c1-22-13-8-9-15(23-2)14(12-13)20-18(21)19-10-11-25-17-7-5-4-6-16(17)24-3/h4-9,12H,10-11H2,1-3H3,(H2,19,20,21) |
| InChIKey | NXVWZBXOKNVRJT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|