C19H26N6O — CID 171713810
(2R)-2-[[6-(benzylamino)-9-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)purin-2-yl]amino]butan-1-ol (PubChem CID 171713810) has the molecular formula C19H26N6O and a molecular weight of 361.50 g/mol. Its IUPAC name is (2R)-2-[[6-(benzylamino)-9-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)purin-2-yl]amino]butan-1-ol.
| Compound Name | (2R)-2-[[6-(benzylamino)-9-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)purin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 171713810 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | (2R)-2-[[6-(benzylamino)-9-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)purin-2-yl]amino]butan-1-ol |
| SMILES | [2H]C([2H])([2H])C([2H])(n1cnc2c(NCc3ccccc3)nc(N[C@H](CC)CO)nc21)C([2H])([2H])[2H] |
| InChI | InChI=1S/C19H26N6O/c1-4-15(11-26)22-19-23-17(20-10-14-8-6-5-7-9-14)16-18(24-19)25(12-21-16)13(2)3/h5-9,12-13,15,26H,4,10-11H2,1-3H3,(H2,20,22,23,24)/t15-/m1/s1/i2D3,3D3,13D |
| InChIKey | BTIHMVBBUGXLCJ-UZFSFWIHSA-N |
| XLogP | 3.20 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |