C46H30N4O6 — CID 171713977
4-[10-(4-carboxyphenyl)-15,20-bis(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 171713977) has the molecular formula C46H30N4O6 and a molecular weight of 734.77 g/mol. Its IUPAC name is 4-[10-(4-carboxyphenyl)-15,20-bis(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10-(4-carboxyphenyl)-15,20-bis(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 171713977 |
| Molecular Formula | C46H30N4O6 |
| Molecular Weight | 734.77 g/mol |
| Exact Mass | 734.22 |
| IUPAC Name | 4-[10-(4-carboxyphenyl)-15,20-bis(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)O)cc4)c4ccc([nH]4)c(-c4ccc(O)cc4)c4nc(c(-c5ccc(O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H30N4O6/c51-31-13-9-27(10-14-31)43-37-21-19-35(48-37)41(25-1-5-29(6-2-25)45(53)54)33-17-18-34(47-33)42(26-3-7-30(8-4-26)46(55)56)36-20-22-38(49-36)44(40-24-23-39(43)50-40)28-11-15-32(52)16-12-28/h1-24,48-49,51-52H,(H,53,54)(H,55,56)/b41-33-,41-35-,42-34-,42-36-,43-37-,43-39-,44-38-,44-40- |
| InChIKey | KXDARVMYACQODE-JAAFTSFNSA-N |
| XLogP | 10.13 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.77 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |