C33H42O5 — CID 171714006
(1S,3aR,7E,9aS)-7-[hydroxy(phenyl)methylidene]-1-(2-hydroxypropan-2-yl)-3a-methyl-5,5-bis(3-methylbut-2-enyl)-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-6,8-dione (PubChem CID 171714006) has the molecular formula C33H42O5 and a molecular weight of 518.69 g/mol. Its IUPAC name is (1S,3aR,7E,9aS)-7-[hydroxy(phenyl)methylidene]-1-(2-hydroxypropan-2-yl)-3a-methyl-5,5-bis(3-methylbut-2-enyl)-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-6,8-dione.
| Compound Name | (1S,3aR,7E,9aS)-7-[hydroxy(phenyl)methylidene]-1-(2-hydroxypropan-2-yl)-3a-methyl-5,5-bis(3-methylbut-2-enyl)-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-6,8-dione |
|---|---|
| PubChem CID | 171714006 |
| Molecular Formula | C33H42O5 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | (1S,3aR,7E,9aS)-7-[hydroxy(phenyl)methylidene]-1-(2-hydroxypropan-2-yl)-3a-methyl-5,5-bis(3-methylbut-2-enyl)-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-6,8-dione |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)/C(=C(/O)c2ccccc2)C(=O)C2=C1O[C@]1(C)CC[C@H](C(C)(C)O)[C@@H]1C2 |
| InChI | InChI=1S/C33H42O5/c1-20(2)13-17-33(18-14-21(3)4)29(36)26(27(34)22-11-9-8-10-12-22)28(35)23-19-25-24(31(5,6)37)15-16-32(25,7)38-30(23)33/h8-14,24-25,34,37H,15-19H2,1-7H3/b27-26+/t24-,25-,32+/m0/s1 |
| InChIKey | MGSIPVIYTJDBDH-BWTQRQPOSA-N |
| XLogP | 7.04 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|