C21H10BrFN2O4 — CID 171714462
19-bromo-7-fluoro-13-hydroxy-23-methyl-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 171714462) has the molecular formula C21H10BrFN2O4 and a molecular weight of 453.22 g/mol. Its IUPAC name is 19-bromo-7-fluoro-13-hydroxy-23-methyl-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 19-bromo-7-fluoro-13-hydroxy-23-methyl-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 171714462 |
| Molecular Formula | C21H10BrFN2O4 |
| Molecular Weight | 453.22 g/mol |
| Exact Mass | 451.98 |
| IUPAC Name | 19-bromo-7-fluoro-13-hydroxy-23-methyl-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | Cn1c2ccc(Br)cc2c2c3c(c4c5cc(F)ccc5oc4c21)C(=O)N(O)C3=O |
| InChI | InChI=1S/C21H10BrFN2O4/c1-24-12-4-2-8(22)6-10(12)14-16-17(21(27)25(28)20(16)26)15-11-7-9(23)3-5-13(11)29-19(15)18(14)24/h2-7,28H,1H3 |
| InChIKey | PIAJISBOSZCPHG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.22 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|