About 9H-carbazole-1,3,5,7-tetrol
9H-carbazole-1,3,5,7-tetrol (PubChem CID 171714982) has the molecular formula C12H9NO4
and a molecular weight of 231.21 g/mol. Its IUPAC name is 9H-carbazole-1,3,5,7-tetrol.
Molecular Properties
| Compound Name | 9H-carbazole-1,3,5,7-tetrol |
| PubChem CID | 171714982 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 9H-carbazole-1,3,5,7-tetrol |
| SMILES | Oc1cc(O)c2c(c1)[nH]c1c(O)cc(O)cc12 |
| InChI | InChI=1S/C12H9NO4/c14-5-1-7-11-8(2-6(15)3-9(11)16)13-12(7)10(17)4-5/h1-4,13-17H |
| InChIKey | SVUXSXIRKBARFE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 96.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9H-carbazole-1,3,5,7-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole-1,3,5,7-tetrol?
The IUPAC name of 9H-carbazole-1,3,5,7-tetrol (CID 171714982) is 9H-carbazole-1,3,5,7-tetrol.
What is the SMILES notation for 9H-carbazole-1,3,5,7-tetrol?
The canonical SMILES for 9H-carbazole-1,3,5,7-tetrol is Oc1cc(O)c2c(c1)[nH]c1c(O)cc(O)cc12.
What is the InChIKey of 9H-carbazole-1,3,5,7-tetrol?
The InChIKey is SVUXSXIRKBARFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO4/c14-5-1-7-11-8(2-6(15)3-9(11)16)13-12(7)10(17)4-5/h1-4,13-17H.
What are the key properties of 9H-carbazole-1,3,5,7-tetrol?
9H-carbazole-1,3,5,7-tetrol has a molecular weight of 231.21 g/mol, XLogP of 2.14, 0 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole-1,3,5,7-tetrol is sourced from PubChem (CID 171714982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).