C12H9NO6 — CID 171715050
9H-carbazole-1,2,3,5,6,8-hexol (PubChem CID 171715050) has the molecular formula C12H9NO6 and a molecular weight of 263.20 g/mol. Its IUPAC name is 9H-carbazole-1,2,3,5,6,8-hexol.
| Compound Name | 9H-carbazole-1,2,3,5,6,8-hexol |
|---|---|
| PubChem CID | 171715050 |
| Molecular Formula | C12H9NO6 |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 9H-carbazole-1,2,3,5,6,8-hexol |
| SMILES | Oc1cc2c([nH]c3c(O)cc(O)c(O)c32)c(O)c1O |
| InChI | InChI=1S/C12H9NO6/c14-4-2-6(16)10(17)7-3-1-5(15)11(18)12(19)8(3)13-9(4)7/h1-2,13-19H |
| InChIKey | HNNLFDBVLPTNLV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|