About 5,7-difluoro-1,2-dimethoxy-9H-carbazole
5,7-difluoro-1,2-dimethoxy-9H-carbazole (PubChem CID 171715061) has the molecular formula C14H11F2NO2
and a molecular weight of 263.24 g/mol. Its IUPAC name is 5,7-difluoro-1,2-dimethoxy-9H-carbazole.
Molecular Properties
| Compound Name | 5,7-difluoro-1,2-dimethoxy-9H-carbazole |
| PubChem CID | 171715061 |
| Molecular Formula | C14H11F2NO2 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 5,7-difluoro-1,2-dimethoxy-9H-carbazole |
| SMILES | COc1ccc2c([nH]c3cc(F)cc(F)c32)c1OC |
| InChI | InChI=1S/C14H11F2NO2/c1-18-11-4-3-8-12-9(16)5-7(15)6-10(12)17-13(8)14(11)19-2/h3-6,17H,1-2H3 |
| InChIKey | BRRCASFECOWLCS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-difluoro-1,2-dimethoxy-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-difluoro-1,2-dimethoxy-9H-carbazole?
The IUPAC name of 5,7-difluoro-1,2-dimethoxy-9H-carbazole (CID 171715061) is 5,7-difluoro-1,2-dimethoxy-9H-carbazole.
What is the SMILES notation for 5,7-difluoro-1,2-dimethoxy-9H-carbazole?
The canonical SMILES for 5,7-difluoro-1,2-dimethoxy-9H-carbazole is COc1ccc2c([nH]c3cc(F)cc(F)c32)c1OC.
What is the InChIKey of 5,7-difluoro-1,2-dimethoxy-9H-carbazole?
The InChIKey is BRRCASFECOWLCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2NO2/c1-18-11-4-3-8-12-9(16)5-7(15)6-10(12)17-13(8)14(11)19-2/h3-6,17H,1-2H3.
What are the key properties of 5,7-difluoro-1,2-dimethoxy-9H-carbazole?
5,7-difluoro-1,2-dimethoxy-9H-carbazole has a molecular weight of 263.24 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-1,2-dimethoxy-9H-carbazole is sourced from PubChem (CID 171715061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).