C26H29FN4O6S — CID 171715911
7-[(1S)-1-[3-(4-aminobutyl)-2,5-dioxoimidazolidin-1-yl]ethyl]-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indole-2-carboxylic acid (PubChem CID 171715911) has the molecular formula C26H29FN4O6S and a molecular weight of 544.61 g/mol. Its IUPAC name is 7-[(1S)-1-[3-(4-aminobutyl)-2,5-dioxoimidazolidin-1-yl]ethyl]-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indole-2-carboxylic acid.
| Compound Name | 7-[(1S)-1-[3-(4-aminobutyl)-2,5-dioxoimidazolidin-1-yl]ethyl]-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 171715911 |
| Molecular Formula | C26H29FN4O6S |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 7-[(1S)-1-[3-(4-aminobutyl)-2,5-dioxoimidazolidin-1-yl]ethyl]-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indole-2-carboxylic acid |
| SMILES | C[C@@H](c1cccc2c(-c3ccc(CS(C)(=O)=O)c(F)c3)c(C(=O)O)[nH]c12)N1C(=O)CN(CCCCN)C1=O |
| InChI | InChI=1S/C26H29FN4O6S/c1-15(31-21(32)13-30(26(31)35)11-4-3-10-28)18-6-5-7-19-22(24(25(33)34)29-23(18)19)16-8-9-17(20(27)12-16)14-38(2,36)37/h5-9,12,15,29H,3-4,10-11,13-14,28H2,1-2H3,(H,33,34)/t15-/m0/s1 |
| InChIKey | CWLGVBVAKRPHNS-HNNXBMFYSA-N |
| XLogP | 3.28 |
| TPSA | 153.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|