C23H31N5O7S — CID 171715926
6-[[4-[(6-carboxy-2-pyridinyl)methyl]-7-(3-sulfopropyl)-1,4,7-triazonan-1-yl]methyl]pyridine-2-carboxylic acid (PubChem CID 171715926) has the molecular formula C23H31N5O7S and a molecular weight of 521.60 g/mol. Its IUPAC name is 6-[[4-[(6-carboxy-2-pyridinyl)methyl]-7-(3-sulfopropyl)-1,4,7-triazonan-1-yl]methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[[4-[(6-carboxy-2-pyridinyl)methyl]-7-(3-sulfopropyl)-1,4,7-triazonan-1-yl]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 171715926 |
| Molecular Formula | C23H31N5O7S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 6-[[4-[(6-carboxy-2-pyridinyl)methyl]-7-(3-sulfopropyl)-1,4,7-triazonan-1-yl]methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(CN2CCN(CCCS(=O)(=O)O)CCN(Cc3cccc(C(=O)O)n3)CC2)n1 |
| InChI | InChI=1S/C23H31N5O7S/c29-22(30)20-6-1-4-18(24-20)16-27-11-9-26(8-3-15-36(33,34)35)10-12-28(14-13-27)17-19-5-2-7-21(25-19)23(31)32/h1-2,4-7H,3,8-17H2,(H,29,30)(H,31,32)(H,33,34,35) |
| InChIKey | YYZIWWSBAADROW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|