C69H45N9 — CID 171716143
2-[3-[3,5-bis(2,3,4-tripyridin-2-ylphenyl)phenyl]-2,6-dipyridin-2-ylphenyl]pyridine (PubChem CID 171716143) has the molecular formula C69H45N9 and a molecular weight of 1000.18 g/mol. Its IUPAC name is 2-[3-[3,5-bis(2,3,4-tripyridin-2-ylphenyl)phenyl]-2,6-dipyridin-2-ylphenyl]pyridine.
| Compound Name | 2-[3-[3,5-bis(2,3,4-tripyridin-2-ylphenyl)phenyl]-2,6-dipyridin-2-ylphenyl]pyridine |
|---|---|
| PubChem CID | 171716143 |
| Molecular Formula | C69H45N9 |
| Molecular Weight | 1000.18 g/mol |
| Exact Mass | 999.38 |
| IUPAC Name | 2-[3-[3,5-bis(2,3,4-tripyridin-2-ylphenyl)phenyl]-2,6-dipyridin-2-ylphenyl]pyridine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccn5)c(-c5ccccn5)c4-c4ccccn4)cc(-c4ccc(-c5ccccn5)c(-c5ccccn5)c4-c4ccccn4)c3)c(-c3ccccn3)c2-c2ccccn2)nc1 |
| InChI | InChI=1S/C69H45N9/c1-10-34-70-55(19-1)52-31-28-49(64(58-22-4-13-37-73-58)67(52)61-25-7-16-40-76-61)46-43-47(50-29-32-53(56-20-2-11-35-71-56)68(62-26-8-17-41-77-62)65(50)59-23-5-14-38-74-59)45-48(44-46)51-30-33-54(57-21-3-12-36-72-57)69(63-27-9-18-42-78-63)66(51)60-24-6-15-39-75-60/h1-45H |
| InChIKey | KDVKEIHYOCPHJG-UHFFFAOYSA-N |
| XLogP | 16.25 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.18 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |