C17H24N2O5 — CID 171716389
1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinane-5-carboxylic acid (PubChem CID 171716389) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinane-5-carboxylic acid.
| Compound Name | 1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinane-5-carboxylic acid |
|---|---|
| PubChem CID | 171716389 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinane-5-carboxylic acid |
| SMILES | O=C(O)C1C(=O)N(C2CCCCC2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C17H24N2O5/c20-14-13(16(22)23)15(21)19(12-9-5-2-6-10-12)17(24)18(14)11-7-3-1-4-8-11/h11-13H,1-10H2,(H,22,23) |
| InChIKey | RDCODJSKYSXJTF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|