C54H55BN4 — CID 171716861
11-tert-butyl-8,14-bis[4-tert-butyl-2-(4-methyl-2-pyridinyl)phenyl]-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 171716861) has the molecular formula C54H55BN4 and a molecular weight of 770.87 g/mol. Its IUPAC name is 11-tert-butyl-8,14-bis[4-tert-butyl-2-(4-methyl-2-pyridinyl)phenyl]-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 11-tert-butyl-8,14-bis[4-tert-butyl-2-(4-methyl-2-pyridinyl)phenyl]-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 171716861 |
| Molecular Formula | C54H55BN4 |
| Molecular Weight | 770.87 g/mol |
| Exact Mass | 770.45 |
| IUPAC Name | 11-tert-butyl-8,14-bis[4-tert-butyl-2-(4-methyl-2-pyridinyl)phenyl]-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | Cc1ccnc(-c2cc(C(C)(C)C)ccc2N2c3ccccc3B3c4ccccc4N(c4ccc(C(C)(C)C)cc4-c4cc(C)ccn4)c4cc(C(C)(C)C)cc2c43)c1 |
| InChI | InChI=1S/C54H55BN4/c1-34-24-26-56-43(28-34)39-30-36(52(3,4)5)20-22-45(39)58-47-18-14-12-16-41(47)55-42-17-13-15-19-48(42)59(50-33-38(54(9,10)11)32-49(58)51(50)55)46-23-21-37(53(6,7)8)31-40(46)44-29-35(2)25-27-57-44/h12-33H,1-11H3 |
| InChIKey | GQHBIBVKMZMFCS-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.87 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|