C54H56FGeIrN3S-2 — CID 171716926
CID 171716926 (PubChem CID 171716926) has the molecular formula C54H56FGeIrN3S-2 and a molecular weight of 1065.97 g/mol.
| Compound Name | CID 171716926 |
|---|---|
| PubChem CID | 171716926 |
| Molecular Formula | C54H56FGeIrN3S-2 |
| Molecular Weight | 1065.97 g/mol |
| Exact Mass | 1067.32 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]cc3sc4cc5c(cc4c3c2)CCC2CCCCC52)nc2ccccc21.[2H]C([2H])([2H])c1cc(-c2[c-]cc(F)cc2)ncc1[Ge](C)(C)C.[Ir] |
| InChI | InChI=1S/C39H39N2S.C15H17FGeN.Ir/c1-23(2)28-12-9-13-29(24(3)4)38(28)41-35-15-8-7-14-34(35)40-39(41)27-18-19-36-32(21-27)33-20-26-17-16-25-10-5-6-11-30(25)31(26)22-37(33)42-36;1-11-9-15(12-5-7-13(16)8-6-12)18-10-14(11)17(2,3)4;/h7-9,12-15,19-25,30H,5-6,10-11,16-17H2,1-4H3;5,7-10H,1-4H3;/q2*-1;/i;1D3; |
| InChIKey | GXMUUFVSGFLWBE-ICMJTWPQSA-N |
| XLogP | 14.87 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.97 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|