C24H35N3O6S — CID 171716945
N-[(15S,16R)-3-methyl-10-oxo-8,18-dioxa-6,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]oxolane-3-sulfonamide (PubChem CID 171716945) has the molecular formula C24H35N3O6S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-[(15S,16R)-3-methyl-10-oxo-8,18-dioxa-6,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]oxolane-3-sulfonamide.
| Compound Name | N-[(15S,16R)-3-methyl-10-oxo-8,18-dioxa-6,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]oxolane-3-sulfonamide |
|---|---|
| PubChem CID | 171716945 |
| Molecular Formula | C24H35N3O6S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-[(15S,16R)-3-methyl-10-oxo-8,18-dioxa-6,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]oxolane-3-sulfonamide |
| SMILES | Cc1ccnc2c1C1CCC(CC1)OC[C@H]1[C@@H](NS(=O)(=O)C3CCOC3)CCCN1C(=O)CO2 |
| InChI | InChI=1S/C24H35N3O6S/c1-16-8-10-25-24-23(16)17-4-6-18(7-5-17)32-14-21-20(3-2-11-27(21)22(28)15-33-24)26-34(29,30)19-9-12-31-13-19/h8,10,17-21,26H,2-7,9,11-15H2,1H3/t17?,18?,19?,20-,21-/m0/s1 |
| InChIKey | ROEBCRAHDKGDCO-VYJKVFMHSA-N |
| XLogP | 1.89 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |