C40H86NO5Si+ — CID 171717064
didecyl-[3-[2,2-dimethylbutoxy-bis(3-hydroxy-2,2-dimethylpropoxy)silyl]propyl]-methylazanium (PubChem CID 171717064) has the molecular formula C40H86NO5Si+ and a molecular weight of 689.22 g/mol. Its IUPAC name is didecyl-[3-[2,2-dimethylbutoxy-bis(3-hydroxy-2,2-dimethylpropoxy)silyl]propyl]-methylazanium.
| Compound Name | didecyl-[3-[2,2-dimethylbutoxy-bis(3-hydroxy-2,2-dimethylpropoxy)silyl]propyl]-methylazanium |
|---|---|
| PubChem CID | 171717064 |
| Molecular Formula | C40H86NO5Si+ |
| Molecular Weight | 689.22 g/mol |
| Exact Mass | 688.63 |
| IUPAC Name | didecyl-[3-[2,2-dimethylbutoxy-bis(3-hydroxy-2,2-dimethylpropoxy)silyl]propyl]-methylazanium |
| SMILES | CCCCCCCCCC[N+](C)(CCCCCCCCCC)CCC[Si](OCC(C)(C)CC)(OCC(C)(C)CO)OCC(C)(C)CO |
| InChI | InChI=1S/C40H86NO5Si/c1-11-14-16-18-20-22-24-26-29-41(10,30-27-25-23-21-19-17-15-12-2)31-28-32-47(44-35-38(4,5)13-3,45-36-39(6,7)33-42)46-37-40(8,9)34-43/h42-43H,11-37H2,1-10H3/q+1 |
| InChIKey | QHHMAHNLODVLBP-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.22 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|