C26H23ClFN3O3 — CID 171717264
tert-butyl N-[4-chloro-3-[[5-[2-(2-fluorophenyl)ethynyl]-3-methyl-2-pyridinyl]carbamoyl]phenyl]carbamate (PubChem CID 171717264) has the molecular formula C26H23ClFN3O3 and a molecular weight of 479.94 g/mol. Its IUPAC name is tert-butyl N-[4-chloro-3-[[5-[2-(2-fluorophenyl)ethynyl]-3-methyl-2-pyridinyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-chloro-3-[[5-[2-(2-fluorophenyl)ethynyl]-3-methyl-2-pyridinyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 171717264 |
| Molecular Formula | C26H23ClFN3O3 |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | tert-butyl N-[4-chloro-3-[[5-[2-(2-fluorophenyl)ethynyl]-3-methyl-2-pyridinyl]carbamoyl]phenyl]carbamate |
| SMILES | Cc1cc(C#Cc2ccccc2F)cnc1NC(=O)c1cc(NC(=O)OC(C)(C)C)ccc1Cl |
| InChI | InChI=1S/C26H23ClFN3O3/c1-16-13-17(9-10-18-7-5-6-8-22(18)28)15-29-23(16)31-24(32)20-14-19(11-12-21(20)27)30-25(33)34-26(2,3)4/h5-8,11-15H,1-4H3,(H,30,33)(H,29,31,32) |
| InChIKey | CFHCFHQJLRNQRC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|