C16H18N6O4 — CID 171718826
2,3-dioxo-5-[(3R)-3-(prop-2-enoylamino)piperidin-1-yl]-1,4-dihydropyrido[3,4-b]pyrazine-8-carboxamide (PubChem CID 171718826) has the molecular formula C16H18N6O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is 2,3-dioxo-5-[(3R)-3-(prop-2-enoylamino)piperidin-1-yl]-1,4-dihydropyrido[3,4-b]pyrazine-8-carboxamide.
| Compound Name | 2,3-dioxo-5-[(3R)-3-(prop-2-enoylamino)piperidin-1-yl]-1,4-dihydropyrido[3,4-b]pyrazine-8-carboxamide |
|---|---|
| PubChem CID | 171718826 |
| Molecular Formula | C16H18N6O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2,3-dioxo-5-[(3R)-3-(prop-2-enoylamino)piperidin-1-yl]-1,4-dihydropyrido[3,4-b]pyrazine-8-carboxamide |
| SMILES | C=CC(=O)N[C@@H]1CCCN(c2ncc(C(N)=O)c3[nH]c(=O)c(=O)[nH]c23)C1 |
| InChI | InChI=1S/C16H18N6O4/c1-2-10(23)19-8-4-3-5-22(7-8)14-12-11(9(6-18-14)13(17)24)20-15(25)16(26)21-12/h2,6,8H,1,3-5,7H2,(H2,17,24)(H,19,23)(H,20,25)(H,21,26)/t8-/m1/s1 |
| InChIKey | VMTFRPHUEOENSY-MRVPVSSYSA-N |
| XLogP | -1.02 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|