C12H13ClOS — CID 171718989
4-(4-chlorophenyl)-5,5-dimethylthiolan-2-one (PubChem CID 171718989) has the molecular formula C12H13ClOS and a molecular weight of 240.75 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5,5-dimethylthiolan-2-one.
| Compound Name | 4-(4-chlorophenyl)-5,5-dimethylthiolan-2-one |
|---|---|
| PubChem CID | 171718989 |
| Molecular Formula | C12H13ClOS |
| Molecular Weight | 240.75 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 4-(4-chlorophenyl)-5,5-dimethylthiolan-2-one |
| SMILES | CC1(C)SC(=O)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClOS/c1-12(2)10(7-11(14)15-12)8-3-5-9(13)6-4-8/h3-6,10H,7H2,1-2H3 |
| InChIKey | HPVGQRJEHDTWBS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.75 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|