C24H31N5O4 — CID 171719030
[(3R,5R)-5-[3-[(3,3-dimethyl-1-oxo-2H-isoindol-5-yl)amino]-1H-pyrazol-5-yl]oxolan-3-yl] (2S,5S)-2,5-dimethylpyrrolidine-1-carboxylate (PubChem CID 171719030) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is [(3R,5R)-5-[3-[(3,3-dimethyl-1-oxo-2H-isoindol-5-yl)amino]-1H-pyrazol-5-yl]oxolan-3-yl] (2S,5S)-2,5-dimethylpyrrolidine-1-carboxylate.
| Compound Name | [(3R,5R)-5-[3-[(3,3-dimethyl-1-oxo-2H-isoindol-5-yl)amino]-1H-pyrazol-5-yl]oxolan-3-yl] (2S,5S)-2,5-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171719030 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | [(3R,5R)-5-[3-[(3,3-dimethyl-1-oxo-2H-isoindol-5-yl)amino]-1H-pyrazol-5-yl]oxolan-3-yl] (2S,5S)-2,5-dimethylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1CC[C@H](C)N1C(=O)O[C@H]1CO[C@@H](c2cc(Nc3ccc4c(c3)C(C)(C)NC4=O)n[nH]2)C1 |
| InChI | InChI=1S/C24H31N5O4/c1-13-5-6-14(2)29(13)23(31)33-16-10-20(32-12-16)19-11-21(28-27-19)25-15-7-8-17-18(9-15)24(3,4)26-22(17)30/h7-9,11,13-14,16,20H,5-6,10,12H2,1-4H3,(H,26,30)(H2,25,27,28)/t13-,14-,16+,20+/m0/s1 |
| InChIKey | NMULGTCQQXVMKO-LPRVAIFDSA-N |
| XLogP | 3.97 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |