About [(1R,2R)-2-methylcyclopropyl] carbamate
[(1R,2R)-2-methylcyclopropyl] carbamate (PubChem CID 171719227) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is [(1R,2R)-2-methylcyclopropyl] carbamate.
Molecular Properties
| Compound Name | [(1R,2R)-2-methylcyclopropyl] carbamate |
| PubChem CID | 171719227 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | [(1R,2R)-2-methylcyclopropyl] carbamate |
| SMILES | C[C@@H]1C[C@H]1OC(N)=O |
| InChI | InChI=1S/C5H9NO2/c1-3-2-4(3)8-5(6)7/h3-4H,2H2,1H3,(H2,6,7)/t3-,4-/m1/s1 |
| InChIKey | HZNLMVXDKYVZDG-QWWZWVQMSA-N |
| XLogP | 0.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,2R)-2-methylcyclopropyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-methylcyclopropyl] carbamate?
The IUPAC name of [(1R,2R)-2-methylcyclopropyl] carbamate (CID 171719227) is [(1R,2R)-2-methylcyclopropyl] carbamate.
What is the SMILES notation for [(1R,2R)-2-methylcyclopropyl] carbamate?
The canonical SMILES for [(1R,2R)-2-methylcyclopropyl] carbamate is C[C@@H]1C[C@H]1OC(N)=O.
What is the InChIKey of [(1R,2R)-2-methylcyclopropyl] carbamate?
The InChIKey is HZNLMVXDKYVZDG-QWWZWVQMSA-N. The full InChI is InChI=1S/C5H9NO2/c1-3-2-4(3)8-5(6)7/h3-4H,2H2,1H3,(H2,6,7)/t3-,4-/m1/s1.
What are the key properties of [(1R,2R)-2-methylcyclopropyl] carbamate?
[(1R,2R)-2-methylcyclopropyl] carbamate has a molecular weight of 115.13 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-methylcyclopropyl] carbamate is sourced from PubChem (CID 171719227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).