C19H20Br2N2O3 — CID 17172041
N-(3,5-dibromo-4-hydroxyphenyl)-4-(2-ethylbutanoylamino)benzamide (PubChem CID 17172041) has the molecular formula C19H20Br2N2O3 and a molecular weight of 484.19 g/mol. Its IUPAC name is N-(3,5-dibromo-4-hydroxyphenyl)-4-(2-ethylbutanoylamino)benzamide.
| Compound Name | N-(3,5-dibromo-4-hydroxyphenyl)-4-(2-ethylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 17172041 |
| Molecular Formula | C19H20Br2N2O3 |
| Molecular Weight | 484.19 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | N-(3,5-dibromo-4-hydroxyphenyl)-4-(2-ethylbutanoylamino)benzamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(C(=O)Nc2cc(Br)c(O)c(Br)c2)cc1 |
| InChI | InChI=1S/C19H20Br2N2O3/c1-3-11(4-2)18(25)22-13-7-5-12(6-8-13)19(26)23-14-9-15(20)17(24)16(21)10-14/h5-11,24H,3-4H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | KNBMGVRUYPFDEK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.19 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|