C62H57BN2 — CID 171720747
CID 171720747 (PubChem CID 171720747) has the molecular formula C62H57BN2 and a molecular weight of 840.96 g/mol.
| Compound Name | CID 171720747 |
|---|---|
| PubChem CID | 171720747 |
| Molecular Formula | C62H57BN2 |
| Molecular Weight | 840.96 g/mol |
| Exact Mass | 840.46 |
| IUPAC Name | — |
| SMILES | CC1(C)C2CCC1(C)[C@@]1(C2)c2ccccc2-c2c1ccc1c2B2c3ccc4c(c3N(c3ccccc3)c3cccc(c32)N1c1ccccc1)-c1ccccc1[C@]41C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C62H57BN2/c1-57(2)38-32-34-59(57,5)61(36-38)44-24-15-13-22-42(44)52-46(61)29-31-51-55(52)63-48-30-28-47-53(43-23-14-16-25-45(43)62(47)37-39-33-35-60(62,6)58(39,3)4)56(48)65(41-20-11-8-12-21-41)50-27-17-26-49(54(50)63)64(51)40-18-9-7-10-19-40/h7-31,38-39H,32-37H2,1-6H3/t38?,39-,59?,60-,61+,62-/m1/s1 |
| InChIKey | WCKPKWSHYPZMQP-NTRYRPPASA-N |
| XLogP | 13.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.96 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|