C17H11FN2O3 — CID 17172115
(E)-N-(1,3-dioxoisoindol-5-yl)-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 17172115) has the molecular formula C17H11FN2O3 and a molecular weight of 310.28 g/mol. Its IUPAC name is (E)-N-(1,3-dioxoisoindol-5-yl)-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-dioxoisoindol-5-yl)-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17172115 |
| Molecular Formula | C17H11FN2O3 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (E)-N-(1,3-dioxoisoindol-5-yl)-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C17H11FN2O3/c18-11-4-1-10(2-5-11)3-8-15(21)19-12-6-7-13-14(9-12)17(23)20-16(13)22/h1-9H,(H,19,21)(H,20,22,23)/b8-3+ |
| InChIKey | VBUIPMZEWXXVRD-FPYGCLRLSA-N |
| XLogP | 2.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|