About 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate
2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate (PubChem CID 171721632) has the molecular formula C21H15F3NO2S+
and a molecular weight of 402.42 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate |
| PubChem CID | 171721632 |
| Molecular Formula | C21H15F3NO2S+ |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate |
| SMILES | O=C(OCC(F)(F)F)c1ccc([S+]2c3ccccc3Nc3ccccc32)cc1 |
| InChI | InChI=1S/C21H15F3NO2S/c22-21(23,24)13-27-20(26)14-9-11-15(12-10-14)28-18-7-3-1-5-16(18)25-17-6-2-4-8-19(17)28/h1-12,25H,13H2/q+1 |
| InChIKey | MJMCKIBDOYHOJB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate?
The IUPAC name of 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate (CID 171721632) is 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate.
What is the SMILES notation for 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate?
The canonical SMILES for 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate is O=C(OCC(F)(F)F)c1ccc([S+]2c3ccccc3Nc3ccccc32)cc1.
What is the InChIKey of 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate?
The InChIKey is MJMCKIBDOYHOJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F3NO2S/c22-21(23,24)13-27-20(26)14-9-11-15(12-10-14)28-18-7-3-1-5-16(18)25-17-6-2-4-8-19(17)28/h1-12,25H,13H2/q+1.
What are the key properties of 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate?
2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate has a molecular weight of 402.42 g/mol, XLogP of 5.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 4-(10H-phenothiazin-5-ium-5-yl)benzoate is sourced from PubChem (CID 171721632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).