C16H13NO5 — CID 17172174
3-[(3-methylbenzoyl)amino]phthalic acid (PubChem CID 17172174) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 3-[(3-methylbenzoyl)amino]phthalic acid.
| Compound Name | 3-[(3-methylbenzoyl)amino]phthalic acid |
|---|---|
| PubChem CID | 17172174 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-[(3-methylbenzoyl)amino]phthalic acid |
| SMILES | Cc1cccc(C(=O)Nc2cccc(C(=O)O)c2C(=O)O)c1 |
| InChI | InChI=1S/C16H13NO5/c1-9-4-2-5-10(8-9)14(18)17-12-7-3-6-11(15(19)20)13(12)16(21)22/h2-8H,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | RCMUAIWIWBJEON-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |