C22H14F6NO2S+ — CID 171721740
1,1,1,3,3,3-hexafluoropropan-2-yl 4-(10H-phenothiazin-5-ium-5-yl)benzoate (PubChem CID 171721740) has the molecular formula C22H14F6NO2S+ and a molecular weight of 470.41 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(10H-phenothiazin-5-ium-5-yl)benzoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(10H-phenothiazin-5-ium-5-yl)benzoate |
|---|---|
| PubChem CID | 171721740 |
| Molecular Formula | C22H14F6NO2S+ |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(10H-phenothiazin-5-ium-5-yl)benzoate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)c1ccc([S+]2c3ccccc3Nc3ccccc32)cc1 |
| InChI | InChI=1S/C22H14F6NO2S/c23-21(24,25)20(22(26,27)28)31-19(30)13-9-11-14(12-10-13)32-17-7-3-1-5-15(17)29-16-6-2-4-8-18(16)32/h1-12,20,29H/q+1 |
| InChIKey | FOVFWIOZCUNLMO-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|