C22H38N2O4 — CID 171722184
4-methoxy-N-[2-[(4-methoxycyclohexanecarbonyl)amino]cyclohexyl]cyclohexane-1-carboxamide (PubChem CID 171722184) has the molecular formula C22H38N2O4 and a molecular weight of 394.56 g/mol. Its IUPAC name is 4-methoxy-N-[2-[(4-methoxycyclohexanecarbonyl)amino]cyclohexyl]cyclohexane-1-carboxamide.
| Compound Name | 4-methoxy-N-[2-[(4-methoxycyclohexanecarbonyl)amino]cyclohexyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 171722184 |
| Molecular Formula | C22H38N2O4 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | 4-methoxy-N-[2-[(4-methoxycyclohexanecarbonyl)amino]cyclohexyl]cyclohexane-1-carboxamide |
| SMILES | COC1CCC(C(=O)NC2CCCCC2NC(=O)C2CCC(OC)CC2)CC1 |
| InChI | InChI=1S/C22H38N2O4/c1-27-17-11-7-15(8-12-17)21(25)23-19-5-3-4-6-20(19)24-22(26)16-9-13-18(28-2)14-10-16/h15-20H,3-14H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | KNWBFYJJIKPQTR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |