C24H42N2O2 — CID 171722262
N-[2-(cyclooctanecarbonylamino)cyclohexyl]cyclooctanecarboxamide (PubChem CID 171722262) has the molecular formula C24H42N2O2 and a molecular weight of 390.61 g/mol. Its IUPAC name is N-[2-(cyclooctanecarbonylamino)cyclohexyl]cyclooctanecarboxamide.
| Compound Name | N-[2-(cyclooctanecarbonylamino)cyclohexyl]cyclooctanecarboxamide |
|---|---|
| PubChem CID | 171722262 |
| Molecular Formula | C24H42N2O2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | N-[2-(cyclooctanecarbonylamino)cyclohexyl]cyclooctanecarboxamide |
| SMILES | O=C(NC1CCCCC1NC(=O)C1CCCCCCC1)C1CCCCCCC1 |
| InChI | InChI=1S/C24H42N2O2/c27-23(19-13-7-3-1-4-8-14-19)25-21-17-11-12-18-22(21)26-24(28)20-15-9-5-2-6-10-16-20/h19-22H,1-18H2,(H,25,27)(H,26,28) |
| InChIKey | NIQPNXZZJCMJFT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |